About ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate
ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate (PubChem CID 118297454) has the molecular formula C14H14F2N2O3
and a molecular weight of 296.27 g/mol. Its IUPAC name is ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate.
Molecular Properties
| Compound Name | ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate |
| PubChem CID | 118297454 |
| Molecular Formula | C14H14F2N2O3 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate |
| SMILES | C=C(NC(=O)c1c(F)cccc1F)/C(=N/C)C(=O)OCC |
| InChI | InChI=1S/C14H14F2N2O3/c1-4-21-14(20)12(17-3)8(2)18-13(19)11-9(15)6-5-7-10(11)16/h5-7H,2,4H2,1,3H3,(H,18,19)/b17-12- |
| InChIKey | CZZORFABHOLPOH-ATVHPVEESA-N |
| XLogP | 1.84 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate?
The IUPAC name of ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate (CID 118297454) is ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate.
What is the SMILES notation for ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate?
The canonical SMILES for ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate is C=C(NC(=O)c1c(F)cccc1F)/C(=N/C)C(=O)OCC.
What is the InChIKey of ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate?
The InChIKey is CZZORFABHOLPOH-ATVHPVEESA-N. The full InChI is InChI=1S/C14H14F2N2O3/c1-4-21-14(20)12(17-3)8(2)18-13(19)11-9(15)6-5-7-10(11)16/h5-7H,2,4H2,1,3H3,(H,18,19)/b17-12-.
What are the key properties of ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate?
ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate has a molecular weight of 296.27 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(2,6-difluorobenzoyl)amino]-2-methyliminobut-3-enoate is sourced from PubChem (CID 118297454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).