C12H20 — CID 11829780
(1R,2R,4S,5S)-2,3,3,4-tetramethyltricyclo[3.3.0.02,4]octane (PubChem CID 11829780) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (1R,2R,4S,5S)-2,3,3,4-tetramethyltricyclo[3.3.0.02,4]octane.
| Compound Name | (1R,2R,4S,5S)-2,3,3,4-tetramethyltricyclo[3.3.0.02,4]octane |
|---|---|
| PubChem CID | 11829780 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (1R,2R,4S,5S)-2,3,3,4-tetramethyltricyclo[3.3.0.02,4]octane |
| SMILES | CC1(C)[C@]2(C)[C@H]3CCC[C@H]3[C@]12C |
| InChI | InChI=1S/C12H20/c1-10(2)11(3)8-6-5-7-9(8)12(10,11)4/h8-9H,5-7H2,1-4H3/t8-,9+,11-,12+ |
| InChIKey | GQACMROBZVSVCB-SKWLPYGWSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |