C21H30N2O2 — CID 118297913
2-[1-[4-[[[(1R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]cyclobutyl]acetic acid (PubChem CID 118297913) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-[1-[4-[[[(1R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[4-[[[(1R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 118297913 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 2-[1-[4-[[[(1R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(N2CCC(CN[C@@H]3CC3c3ccccc3)CC2)CCC1 |
| InChI | InChI=1S/C21H30N2O2/c24-20(25)14-21(9-4-10-21)23-11-7-16(8-12-23)15-22-19-13-18(19)17-5-2-1-3-6-17/h1-3,5-6,16,18-19,22H,4,7-15H2,(H,24,25)/t18?,19-/m1/s1 |
| InChIKey | ATMPNNXKBAQDJV-MUMRKEEXSA-N |
| XLogP | 3.24 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |