C18H37N3O2 — CID 118297969
6-amino-4-formamido-2-methyl-N-(2,4,4-trimethylpentan-2-yl)octanamide (PubChem CID 118297969) has the molecular formula C18H37N3O2 and a molecular weight of 327.51 g/mol. Its IUPAC name is 6-amino-4-formamido-2-methyl-N-(2,4,4-trimethylpentan-2-yl)octanamide.
| Compound Name | 6-amino-4-formamido-2-methyl-N-(2,4,4-trimethylpentan-2-yl)octanamide |
|---|---|
| PubChem CID | 118297969 |
| Molecular Formula | C18H37N3O2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 6-amino-4-formamido-2-methyl-N-(2,4,4-trimethylpentan-2-yl)octanamide |
| SMILES | CCC(N)CC(CC(C)C(=O)NC(C)(C)CC(C)(C)C)NC=O |
| InChI | InChI=1S/C18H37N3O2/c1-8-14(19)10-15(20-12-22)9-13(2)16(23)21-18(6,7)11-17(3,4)5/h12-15H,8-11,19H2,1-7H3,(H,20,22)(H,21,23) |
| InChIKey | IPCAHGIENNOBIQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|