About 6-cyclohexyl-3,6-dihydro-2H-pyran
6-cyclohexyl-3,6-dihydro-2H-pyran (PubChem CID 11829812) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 6-cyclohexyl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-cyclohexyl-3,6-dihydro-2H-pyran |
| PubChem CID | 11829812 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 6-cyclohexyl-3,6-dihydro-2H-pyran |
| SMILES | C1=CC(C2CCCCC2)OCC1 |
| InChI | InChI=1S/C11H18O/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h4,8,10-11H,1-3,5-7,9H2 |
| InChIKey | PMZBNAUDEPEPIN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclohexyl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexyl-3,6-dihydro-2H-pyran?
The IUPAC name of 6-cyclohexyl-3,6-dihydro-2H-pyran (CID 11829812) is 6-cyclohexyl-3,6-dihydro-2H-pyran.
What is the SMILES notation for 6-cyclohexyl-3,6-dihydro-2H-pyran?
The canonical SMILES for 6-cyclohexyl-3,6-dihydro-2H-pyran is C1=CC(C2CCCCC2)OCC1.
What is the InChIKey of 6-cyclohexyl-3,6-dihydro-2H-pyran?
The InChIKey is PMZBNAUDEPEPIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h4,8,10-11H,1-3,5-7,9H2.
What are the key properties of 6-cyclohexyl-3,6-dihydro-2H-pyran?
6-cyclohexyl-3,6-dihydro-2H-pyran has a molecular weight of 166.26 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexyl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 11829812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).