C36H52O8S — CID 118298825
2,5-bis(4-tert-butyl-2,6-dimethoxyphenyl)-3,4-bis(2-methoxyethoxymethyl)thiophene (PubChem CID 118298825) has the molecular formula C36H52O8S and a molecular weight of 644.87 g/mol. Its IUPAC name is 2,5-bis(4-tert-butyl-2,6-dimethoxyphenyl)-3,4-bis(2-methoxyethoxymethyl)thiophene.
| Compound Name | 2,5-bis(4-tert-butyl-2,6-dimethoxyphenyl)-3,4-bis(2-methoxyethoxymethyl)thiophene |
|---|---|
| PubChem CID | 118298825 |
| Molecular Formula | C36H52O8S |
| Molecular Weight | 644.87 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | 2,5-bis(4-tert-butyl-2,6-dimethoxyphenyl)-3,4-bis(2-methoxyethoxymethyl)thiophene |
| SMILES | COCCOCc1c(-c2c(OC)cc(C(C)(C)C)cc2OC)sc(-c2c(OC)cc(C(C)(C)C)cc2OC)c1COCCOC |
| InChI | InChI=1S/C36H52O8S/c1-35(2,3)23-17-27(39-9)31(28(18-23)40-10)33-25(21-43-15-13-37-7)26(22-44-16-14-38-8)34(45-33)32-29(41-11)19-24(36(4,5)6)20-30(32)42-12/h17-20H,13-16,21-22H2,1-12H3 |
| InChIKey | QWIZYQXTBHMWPJ-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.87 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|