C28H36Cl2N6O4 — CID 118299125
6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-[3-(dimethylamino)propylamino]-8-[2-(1-prop-2-enylazetidin-3-yl)oxyethyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 118299125) has the molecular formula C28H36Cl2N6O4 and a molecular weight of 591.54 g/mol. Its IUPAC name is 6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-[3-(dimethylamino)propylamino]-8-[2-(1-prop-2-enylazetidin-3-yl)oxyethyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-[3-(dimethylamino)propylamino]-8-[2-(1-prop-2-enylazetidin-3-yl)oxyethyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 118299125 |
| Molecular Formula | C28H36Cl2N6O4 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-[3-(dimethylamino)propylamino]-8-[2-(1-prop-2-enylazetidin-3-yl)oxyethyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CCN1CC(OCCn2c(=O)c(-c3c(Cl)c(OC)cc(OC)c3Cl)cc3cnc(NCCCN(C)C)nc32)C1 |
| InChI | InChI=1S/C28H36Cl2N6O4/c1-6-9-35-16-19(17-35)40-12-11-36-26-18(15-32-28(33-26)31-8-7-10-34(2)3)13-20(27(36)37)23-24(29)21(38-4)14-22(39-5)25(23)30/h6,13-15,19H,1,7-12,16-17H2,2-5H3,(H,31,32,33) |
| InChIKey | LLFSBFBPIZFBOG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|