About 2-(2,5-dioxopyrrol-1-yl)acetyl chloride
2-(2,5-dioxopyrrol-1-yl)acetyl chloride (PubChem CID 11829930) has the molecular formula C6H4ClNO3
and a molecular weight of 173.56 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)acetyl chloride.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)acetyl chloride |
| PubChem CID | 11829930 |
| Molecular Formula | C6H4ClNO3 |
| Molecular Weight | 173.56 g/mol |
| Exact Mass | 172.99 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)acetyl chloride |
| SMILES | O=C(Cl)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H4ClNO3/c7-4(9)3-8-5(10)1-2-6(8)11/h1-2H,3H2 |
| InChIKey | CCBYJMUYIDMBHE-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.56 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrol-1-yl)acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrol-1-yl)acetyl chloride?
The IUPAC name of 2-(2,5-dioxopyrrol-1-yl)acetyl chloride (CID 11829930) is 2-(2,5-dioxopyrrol-1-yl)acetyl chloride.
What is the SMILES notation for 2-(2,5-dioxopyrrol-1-yl)acetyl chloride?
The canonical SMILES for 2-(2,5-dioxopyrrol-1-yl)acetyl chloride is O=C(Cl)CN1C(=O)C=CC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrol-1-yl)acetyl chloride?
The InChIKey is CCBYJMUYIDMBHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO3/c7-4(9)3-8-5(10)1-2-6(8)11/h1-2H,3H2.
What are the key properties of 2-(2,5-dioxopyrrol-1-yl)acetyl chloride?
2-(2,5-dioxopyrrol-1-yl)acetyl chloride has a molecular weight of 173.56 g/mol, XLogP of -0.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrol-1-yl)acetyl chloride is sourced from PubChem (CID 11829930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).