C23H36F2N7O9P — CID 118299579
propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-7-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]amino]propanoate (PubChem CID 118299579) has the molecular formula C23H36F2N7O9P and a molecular weight of 623.55 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-7-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-7-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118299579 |
| Molecular Formula | C23H36F2N7O9P |
| Molecular Weight | 623.55 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-7-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(N[C@@H](C)C(=O)OC(C)C)OC[C@@]1(C(F)F)O[C@@H](n2cnc3ncnc(N)c32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H36F2N7O9P/c1-10(2)39-20(35)12(5)30-42(37,31-13(6)21(36)40-11(3)4)38-7-23(22(24)25)16(34)15(33)19(41-23)32-9-29-18-14(32)17(26)27-8-28-18/h8-13,15-16,19,22,33-34H,7H2,1-6H3,(H2,26,27,28)(H2,30,31,37)/t12-,13-,15+,16-,19+,23+/m0/s1 |
| InChIKey | FQAAYQNWBPYPHG-BKYGAQAASA-N |
| XLogP | 0.65 |
| TPSA | 222.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.55 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|