C17H16F4N3O7P — CID 118299623
4-amino-1-[(2R,3R,4R,5R)-5-(difluoromethyl)-3-fluoro-4-hydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyrimidin-2-one (PubChem CID 118299623) has the molecular formula C17H16F4N3O7P and a molecular weight of 481.30 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4R,5R)-5-(difluoromethyl)-3-fluoro-4-hydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4R,5R)-5-(difluoromethyl)-3-fluoro-4-hydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyrimidin-2-one |
|---|---|
| PubChem CID | 118299623 |
| Molecular Formula | C17H16F4N3O7P |
| Molecular Weight | 481.30 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 4-amino-1-[(2R,3R,4R,5R)-5-(difluoromethyl)-3-fluoro-4-hydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyrimidin-2-one |
| SMILES | Nc1nc(=O)n([C@@H]2O[C@@](COP3(=O)OCc4ccccc4O3)(C(F)F)[C@@H](O)[C@H]2F)cc1F |
| InChI | InChI=1S/C17H16F4N3O7P/c18-9-5-24(16(26)23-13(9)22)14-11(19)12(25)17(30-14,15(20)21)7-29-32(27)28-6-8-3-1-2-4-10(8)31-32/h1-5,11-12,14-15,25H,6-7H2,(H2,22,23,26)/t11-,12+,14-,17-,32?/m1/s1 |
| InChIKey | NRHCJIIJTLUGCN-YXYBXMRYSA-N |
| XLogP | 1.93 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|