About 8-nitroquinoline
8-nitroquinoline (PubChem CID 11830) has the molecular formula C9H6N2O2
and a molecular weight of 174.16 g/mol. Its IUPAC name is 8-nitroquinoline.
Molecular Properties
| Compound Name | 8-nitroquinoline |
| PubChem CID | 11830 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 8-nitroquinoline |
| SMILES | O=[N+]([O-])c1cccc2cccnc12 |
| InChI | InChI=1S/C9H6N2O2/c12-11(13)8-5-1-3-7-4-2-6-10-9(7)8/h1-6H |
| InChIKey | OQHHSGRZCKGLCY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-nitroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitroquinoline?
The IUPAC name of 8-nitroquinoline (CID 11830) is 8-nitroquinoline.
What is the SMILES notation for 8-nitroquinoline?
The canonical SMILES for 8-nitroquinoline is O=[N+]([O-])c1cccc2cccnc12.
What is the InChIKey of 8-nitroquinoline?
The InChIKey is OQHHSGRZCKGLCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2/c12-11(13)8-5-1-3-7-4-2-6-10-9(7)8/h1-6H.
What are the key properties of 8-nitroquinoline?
8-nitroquinoline has a molecular weight of 174.16 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitroquinoline is sourced from PubChem (CID 11830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).