About 2-nitro-1-benzothiophene
2-nitro-1-benzothiophene (PubChem CID 11830017) has the molecular formula C8H5NO2S
and a molecular weight of 179.20 g/mol. Its IUPAC name is 2-nitro-1-benzothiophene.
Molecular Properties
| Compound Name | 2-nitro-1-benzothiophene |
| PubChem CID | 11830017 |
| Molecular Formula | C8H5NO2S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.00 |
| IUPAC Name | 2-nitro-1-benzothiophene |
| SMILES | O=[N+]([O-])c1cc2ccccc2s1 |
| InChI | InChI=1S/C8H5NO2S/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H |
| InChIKey | OEEJLOZQSKNWQQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-1-benzothiophene?
The IUPAC name of 2-nitro-1-benzothiophene (CID 11830017) is 2-nitro-1-benzothiophene.
What is the SMILES notation for 2-nitro-1-benzothiophene?
The canonical SMILES for 2-nitro-1-benzothiophene is O=[N+]([O-])c1cc2ccccc2s1.
What is the InChIKey of 2-nitro-1-benzothiophene?
The InChIKey is OEEJLOZQSKNWQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2S/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H.
What are the key properties of 2-nitro-1-benzothiophene?
2-nitro-1-benzothiophene has a molecular weight of 179.20 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-1-benzothiophene is sourced from PubChem (CID 11830017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).