C19H29FO9 — CID 118300215
methyl 2-acetyloxy-6-[(1R,2R)-1,2-diacetyloxybutyl]-3-fluoro-4,5-dimethyloxane-2-carboxylate (PubChem CID 118300215) has the molecular formula C19H29FO9 and a molecular weight of 420.43 g/mol. Its IUPAC name is methyl 2-acetyloxy-6-[(1R,2R)-1,2-diacetyloxybutyl]-3-fluoro-4,5-dimethyloxane-2-carboxylate.
| Compound Name | methyl 2-acetyloxy-6-[(1R,2R)-1,2-diacetyloxybutyl]-3-fluoro-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 118300215 |
| Molecular Formula | C19H29FO9 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | methyl 2-acetyloxy-6-[(1R,2R)-1,2-diacetyloxybutyl]-3-fluoro-4,5-dimethyloxane-2-carboxylate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1OC(OC(C)=O)(C(=O)OC)C(F)C(C)C1C |
| InChI | InChI=1S/C19H29FO9/c1-8-14(26-11(4)21)16(27-12(5)22)15-9(2)10(3)17(20)19(29-15,18(24)25-7)28-13(6)23/h9-10,14-17H,8H2,1-7H3/t9?,10?,14-,15?,16-,17?,19?/m1/s1 |
| InChIKey | JTNCJUCUBOVOOL-DKNOUPPDSA-N |
| XLogP | 1.70 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|