C17H27FO8 — CID 118300216
methyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-3-fluoro-2-hydroxy-4,5-dimethyloxane-2-carboxylate (PubChem CID 118300216) has the molecular formula C17H27FO8 and a molecular weight of 378.39 g/mol. Its IUPAC name is methyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-3-fluoro-2-hydroxy-4,5-dimethyloxane-2-carboxylate.
| Compound Name | methyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-3-fluoro-2-hydroxy-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 118300216 |
| Molecular Formula | C17H27FO8 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | methyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-3-fluoro-2-hydroxy-4,5-dimethyloxane-2-carboxylate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1OC(O)(C(=O)OC)C(F)C(C)C1C |
| InChI | InChI=1S/C17H27FO8/c1-7-12(24-10(4)19)14(25-11(5)20)13-8(2)9(3)15(18)17(22,26-13)16(21)23-6/h8-9,12-15,22H,7H2,1-6H3/t8?,9?,12-,13?,14-,15?,17?/m1/s1 |
| InChIKey | OTTICAKKTBMSTR-QNWPTCCKSA-N |
| XLogP | 1.13 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|