C17H26F2O7 — CID 118300218
methyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-2,3-difluoro-4,5-dimethyloxane-2-carboxylate (PubChem CID 118300218) has the molecular formula C17H26F2O7 and a molecular weight of 380.38 g/mol. Its IUPAC name is methyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-2,3-difluoro-4,5-dimethyloxane-2-carboxylate.
| Compound Name | methyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-2,3-difluoro-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 118300218 |
| Molecular Formula | C17H26F2O7 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | methyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-2,3-difluoro-4,5-dimethyloxane-2-carboxylate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1OC(F)(C(=O)OC)C(F)C(C)C1C |
| InChI | InChI=1S/C17H26F2O7/c1-7-12(24-10(4)20)14(25-11(5)21)13-8(2)9(3)15(18)17(19,26-13)16(22)23-6/h8-9,12-15H,7H2,1-6H3/t8?,9?,12-,13?,14-,15?,17?/m1/s1 |
| InChIKey | WBRIBGLCGYAZCY-QNWPTCCKSA-N |
| XLogP | 2.11 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|