C18H30O4 — CID 118300374
2,2,3,3,10,10,11,11-octamethyl-1,4,9,12-tetraoxadispiro[4.2.48.25]tetradec-13-ene (PubChem CID 118300374) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 2,2,3,3,10,10,11,11-octamethyl-1,4,9,12-tetraoxadispiro[4.2.48.25]tetradec-13-ene.
| Compound Name | 2,2,3,3,10,10,11,11-octamethyl-1,4,9,12-tetraoxadispiro[4.2.48.25]tetradec-13-ene |
|---|---|
| PubChem CID | 118300374 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2,2,3,3,10,10,11,11-octamethyl-1,4,9,12-tetraoxadispiro[4.2.48.25]tetradec-13-ene |
| SMILES | CC1(C)OC2(C=CC3(CC2)OC(C)(C)C(C)(C)O3)OC1(C)C |
| InChI | InChI=1S/C18H30O4/c1-13(2)14(3,4)20-17(19-13)9-11-18(12-10-17)21-15(5,6)16(7,8)22-18/h9,11H,10,12H2,1-8H3 |
| InChIKey | XRSCKEDNGQQEGE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|