C26H48N2O2 — CID 118300534
(Z)-2,4,11-trimethyl-4,9-bis[methyl(propan-2-yl)amino]-9-prop-2-enyldodec-6-ene-3,10-dione (PubChem CID 118300534) has the molecular formula C26H48N2O2 and a molecular weight of 420.68 g/mol. Its IUPAC name is (Z)-2,4,11-trimethyl-4,9-bis[methyl(propan-2-yl)amino]-9-prop-2-enyldodec-6-ene-3,10-dione.
| Compound Name | (Z)-2,4,11-trimethyl-4,9-bis[methyl(propan-2-yl)amino]-9-prop-2-enyldodec-6-ene-3,10-dione |
|---|---|
| PubChem CID | 118300534 |
| Molecular Formula | C26H48N2O2 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.37 |
| IUPAC Name | (Z)-2,4,11-trimethyl-4,9-bis[methyl(propan-2-yl)amino]-9-prop-2-enyldodec-6-ene-3,10-dione |
| SMILES | C=CCC(C/C=C\CC(C)(C(=O)C(C)C)N(C)C(C)C)(C(=O)C(C)C)N(C)C(C)C |
| InChI | InChI=1S/C26H48N2O2/c1-13-16-26(24(30)20(4)5,28(12)22(8)9)18-15-14-17-25(10,23(29)19(2)3)27(11)21(6)7/h13-15,19-22H,1,16-18H2,2-12H3/b15-14- |
| InChIKey | WDIMSONWMMSTDD-PFONDFGASA-N |
| XLogP | 5.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|