About 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane
4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane (PubChem CID 118300585) has the molecular formula C12H23FO2
and a molecular weight of 218.31 g/mol. Its IUPAC name is 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane |
| PubChem CID | 118300585 |
| Molecular Formula | C12H23FO2 |
| Molecular Weight | 218.31 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane |
| SMILES | CC1(F)OC(C(C)(C)C)C(C(C)(C)C)O1 |
| InChI | InChI=1S/C12H23FO2/c1-10(2,3)8-9(11(4,5)6)15-12(7,13)14-8/h8-9H,1-7H3 |
| InChIKey | ITPRRBHGWQVGCW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane?
The IUPAC name of 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane (CID 118300585) is 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane.
What is the SMILES notation for 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane?
The canonical SMILES for 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane is CC1(F)OC(C(C)(C)C)C(C(C)(C)C)O1.
What is the InChIKey of 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane?
The InChIKey is ITPRRBHGWQVGCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23FO2/c1-10(2,3)8-9(11(4,5)6)15-12(7,13)14-8/h8-9H,1-7H3.
What are the key properties of 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane?
4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane has a molecular weight of 218.31 g/mol, XLogP of 3.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-ditert-butyl-2-fluoro-2-methyl-1,3-dioxolane is sourced from PubChem (CID 118300585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).