C11H20F2O2 — CID 118300586
4,5-ditert-butyl-2,2-difluoro-1,3-dioxolane (PubChem CID 118300586) has the molecular formula C11H20F2O2 and a molecular weight of 222.27 g/mol. Its IUPAC name is 4,5-ditert-butyl-2,2-difluoro-1,3-dioxolane.
| Compound Name | 4,5-ditert-butyl-2,2-difluoro-1,3-dioxolane |
|---|---|
| PubChem CID | 118300586 |
| Molecular Formula | C11H20F2O2 |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4,5-ditert-butyl-2,2-difluoro-1,3-dioxolane |
| SMILES | CC(C)(C)C1OC(F)(F)OC1C(C)(C)C |
| InChI | InChI=1S/C11H20F2O2/c1-9(2,3)7-8(10(4,5)6)15-11(12,13)14-7/h7-8H,1-6H3 |
| InChIKey | DBAZEBMQALOMOG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |