About trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate
trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate (PubChem CID 11830067) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate |
| PubChem CID | 11830067 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C(=C(C)C)CC[C@H]1C |
| InChI | InChI=1S/C11H18O2/c1-7(2)9-6-5-8(3)10(9)11(12)13-4/h8,10H,5-6H2,1-4H3/t8-,10-/m1/s1 |
| InChIKey | DVRISWLNCBSESY-PSASIEDQSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate?
The IUPAC name of trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate (CID 11830067) is trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate.
What is the SMILES notation for trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate?
The canonical SMILES for trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate is COC(=O)[C@H]1C(=C(C)C)CC[C@H]1C.
What is the InChIKey of trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate?
The InChIKey is DVRISWLNCBSESY-PSASIEDQSA-N. The full InChI is InChI=1S/C11H18O2/c1-7(2)9-6-5-8(3)10(9)11(12)13-4/h8,10H,5-6H2,1-4H3/t8-,10-/m1/s1.
What are the key properties of trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate?
trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate has a molecular weight of 182.26 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1R,2R)-2-methyl-5-propan-2-ylidenecyclopentane-1-carboxylate is sourced from PubChem (CID 11830067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).