About (1-diazo-2,2,2-trifluoroethyl)benzene
(1-diazo-2,2,2-trifluoroethyl)benzene (PubChem CID 11830127) has the molecular formula C8H5F3N2
and a molecular weight of 186.14 g/mol. Its IUPAC name is (1-diazo-2,2,2-trifluoroethyl)benzene.
Molecular Properties
| Compound Name | (1-diazo-2,2,2-trifluoroethyl)benzene |
| PubChem CID | 11830127 |
| Molecular Formula | C8H5F3N2 |
| Molecular Weight | 186.14 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | (1-diazo-2,2,2-trifluoroethyl)benzene |
| SMILES | [N-]=[N+]=C(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C8H5F3N2/c9-8(10,11)7(13-12)6-4-2-1-3-5-6/h1-5H |
| InChIKey | PFAJYVGLAPJBAG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (1-diazo-2,2,2-trifluoroethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-diazo-2,2,2-trifluoroethyl)benzene?
The IUPAC name of (1-diazo-2,2,2-trifluoroethyl)benzene (CID 11830127) is (1-diazo-2,2,2-trifluoroethyl)benzene.
What is the SMILES notation for (1-diazo-2,2,2-trifluoroethyl)benzene?
The canonical SMILES for (1-diazo-2,2,2-trifluoroethyl)benzene is [N-]=[N+]=C(c1ccccc1)C(F)(F)F.
What is the InChIKey of (1-diazo-2,2,2-trifluoroethyl)benzene?
The InChIKey is PFAJYVGLAPJBAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3N2/c9-8(10,11)7(13-12)6-4-2-1-3-5-6/h1-5H.
What are the key properties of (1-diazo-2,2,2-trifluoroethyl)benzene?
(1-diazo-2,2,2-trifluoroethyl)benzene has a molecular weight of 186.14 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1-diazo-2,2,2-trifluoroethyl)benzene is sourced from PubChem (CID 11830127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).