C12H13F3O7S — CID 118301410
methyl (1'R,6'S)-2'-(trifluoromethylsulfonyloxy)spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-2-ene]-3'-carboxylate (PubChem CID 118301410) has the molecular formula C12H13F3O7S and a molecular weight of 358.29 g/mol. Its IUPAC name is methyl (1'R,6'S)-2'-(trifluoromethylsulfonyloxy)spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-2-ene]-3'-carboxylate.
| Compound Name | methyl (1'R,6'S)-2'-(trifluoromethylsulfonyloxy)spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-2-ene]-3'-carboxylate |
|---|---|
| PubChem CID | 118301410 |
| Molecular Formula | C12H13F3O7S |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | methyl (1'R,6'S)-2'-(trifluoromethylsulfonyloxy)spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-2-ene]-3'-carboxylate |
| SMILES | COC(=O)C1=C(OS(=O)(=O)C(F)(F)F)[C@@H]2C[C@@H]2C2(C1)OCCO2 |
| InChI | InChI=1S/C12H13F3O7S/c1-19-10(16)7-5-11(20-2-3-21-11)8-4-6(8)9(7)22-23(17,18)12(13,14)15/h6,8H,2-5H2,1H3/t6-,8+/m1/s1 |
| InChIKey | OUMPAMKMNAIIEX-SVRRBLITSA-N |
| XLogP | 1.06 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|