About 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole
4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole (PubChem CID 118301780) has the molecular formula C9H13F3N2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole.
Molecular Properties
| Compound Name | 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole |
| PubChem CID | 118301780 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole |
| SMILES | CC(C)Cc1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C9H13F3N2/c1-7(2)3-8-4-13-14(5-8)6-9(10,11)12/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | JNVLLMZWSSIVFD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole?
The IUPAC name of 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole (CID 118301780) is 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole.
What is the SMILES notation for 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole?
The canonical SMILES for 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole is CC(C)Cc1cnn(CC(F)(F)F)c1.
What is the InChIKey of 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole?
The InChIKey is JNVLLMZWSSIVFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2/c1-7(2)3-8-4-13-14(5-8)6-9(10,11)12/h4-5,7H,3,6H2,1-2H3.
What are the key properties of 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole?
4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole has a molecular weight of 206.21 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)pyrazole is sourced from PubChem (CID 118301780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).