C28H29F6NO3 — CID 118301905
(3S)-3-[3-[[2-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]phenyl]-3-cyclopropylpropanoic acid (PubChem CID 118301905) has the molecular formula C28H29F6NO3 and a molecular weight of 541.53 g/mol. Its IUPAC name is (3S)-3-[3-[[2-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]phenyl]-3-cyclopropylpropanoic acid.
| Compound Name | (3S)-3-[3-[[2-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]phenyl]-3-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 118301905 |
| Molecular Formula | C28H29F6NO3 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | (3S)-3-[3-[[2-[[2,5-bis(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]phenyl]-3-cyclopropylpropanoic acid |
| SMILES | O=C(O)C[C@H](c1cccc(OC2CC3CN(Cc4cc(C(F)(F)F)ccc4C(F)(F)F)CC3C2)c1)C1CC1 |
| InChI | InChI=1S/C28H29F6NO3/c29-27(30,31)21-6-7-25(28(32,33)34)20(8-21)15-35-13-18-10-23(11-19(18)14-35)38-22-3-1-2-17(9-22)24(12-26(36)37)16-4-5-16/h1-3,6-9,16,18-19,23-24H,4-5,10-15H2,(H,36,37)/t18?,19?,23?,24-/m0/s1 |
| InChIKey | RSGMVFCYYPLYMF-SPRQQXBQSA-N |
| XLogP | 6.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |