C8H12N2 — CID 118301966
[(2Z,4Z)-6-methylhepta-2,4,6-trien-2-yl]diazene (PubChem CID 118301966) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is [(2Z,4Z)-6-methylhepta-2,4,6-trien-2-yl]diazene.
| Compound Name | [(2Z,4Z)-6-methylhepta-2,4,6-trien-2-yl]diazene |
|---|---|
| PubChem CID | 118301966 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | [(2Z,4Z)-6-methylhepta-2,4,6-trien-2-yl]diazene |
| SMILES | [H]/N=N/C(C)=C\C=C/C(=C)C |
| InChI | InChI=1S/C8H12N2/c1-7(2)5-4-6-8(3)10-9/h4-6,9H,1H2,2-3H3/b5-4-,8-6-,10-9+ |
| InChIKey | WNSMKAIVQRMJSF-MABSOFHGSA-N |
| XLogP | 3.05 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|