C14H13ClF4N4O3S — CID 118302040
N-(2-chloro-4-pyridinyl)-3-fluoro-1-methyl-4-[[(2R)-1,1,1-trifluoropropan-2-yl]sulfamoyl]pyrrole-2-carboxamide (PubChem CID 118302040) has the molecular formula C14H13ClF4N4O3S and a molecular weight of 428.80 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-3-fluoro-1-methyl-4-[[(2R)-1,1,1-trifluoropropan-2-yl]sulfamoyl]pyrrole-2-carboxamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-3-fluoro-1-methyl-4-[[(2R)-1,1,1-trifluoropropan-2-yl]sulfamoyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118302040 |
| Molecular Formula | C14H13ClF4N4O3S |
| Molecular Weight | 428.80 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-3-fluoro-1-methyl-4-[[(2R)-1,1,1-trifluoropropan-2-yl]sulfamoyl]pyrrole-2-carboxamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cn(C)c(C(=O)Nc2ccnc(Cl)c2)c1F)C(F)(F)F |
| InChI | InChI=1S/C14H13ClF4N4O3S/c1-7(14(17,18)19)22-27(25,26)9-6-23(2)12(11(9)16)13(24)21-8-3-4-20-10(15)5-8/h3-7,22H,1-2H3,(H,20,21,24)/t7-/m1/s1 |
| InChIKey | IROZBYYNDDPSLH-SSDOTTSWSA-N |
| XLogP | 2.69 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.80 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|