C6H7BrO2 — CID 11830237
(1S,2S)-3-bromocyclohexa-3,5-diene-1,2-diol (PubChem CID 11830237) has the molecular formula C6H7BrO2 and a molecular weight of 191.02 g/mol. Its IUPAC name is (1S,2S)-3-bromocyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2S)-3-bromocyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 11830237 |
| Molecular Formula | C6H7BrO2 |
| Molecular Weight | 191.02 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | (1S,2S)-3-bromocyclohexa-3,5-diene-1,2-diol |
| SMILES | O[C@@H]1C(Br)=CC=C[C@@H]1O |
| InChI | InChI=1S/C6H7BrO2/c7-4-2-1-3-5(8)6(4)9/h1-3,5-6,8-9H/t5-,6+/m0/s1 |
| InChIKey | KLPGXZKAVBGFGF-NTSWFWBYSA-N |
| XLogP | 0.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.02 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |