C70H72N2O2S2 — CID 118302713
N-(4-ethenylphenyl)-5-[4-[5-(4-ethenyl-N-(4-phenylphenyl)anilino)thiophen-2-yl]-2,5-dioctoxyphenyl]-N-(4-phenylphenyl)thiophen-2-amine (PubChem CID 118302713) has the molecular formula C70H72N2O2S2 and a molecular weight of 1037.49 g/mol. Its IUPAC name is N-(4-ethenylphenyl)-5-[4-[5-(4-ethenyl-N-(4-phenylphenyl)anilino)thiophen-2-yl]-2,5-dioctoxyphenyl]-N-(4-phenylphenyl)thiophen-2-amine.
| Compound Name | N-(4-ethenylphenyl)-5-[4-[5-(4-ethenyl-N-(4-phenylphenyl)anilino)thiophen-2-yl]-2,5-dioctoxyphenyl]-N-(4-phenylphenyl)thiophen-2-amine |
|---|---|
| PubChem CID | 118302713 |
| Molecular Formula | C70H72N2O2S2 |
| Molecular Weight | 1037.49 g/mol |
| Exact Mass | 1036.50 |
| IUPAC Name | N-(4-ethenylphenyl)-5-[4-[5-(4-ethenyl-N-(4-phenylphenyl)anilino)thiophen-2-yl]-2,5-dioctoxyphenyl]-N-(4-phenylphenyl)thiophen-2-amine |
| SMILES | C=Cc1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3cc(OCCCCCCCC)c(-c4ccc(N(c5ccc(C=C)cc5)c5ccc(-c6ccccc6)cc5)s4)cc3OCCCCCCCC)s2)cc1 |
| InChI | InChI=1S/C70H72N2O2S2/c1-5-9-11-13-15-23-49-73-65-51-64(68-46-48-70(76-68)72(60-39-31-54(8-4)32-40-60)62-43-35-58(36-44-62)56-27-21-18-22-28-56)66(74-50-24-16-14-12-10-6-2)52-63(65)67-45-47-69(75-67)71(59-37-29-53(7-3)30-38-59)61-41-33-57(34-42-61)55-25-19-17-20-26-55/h7-8,17-22,25-48,51-52H,3-6,9-16,23-24,49-50H2,1-2H3 |
| InChIKey | OMLNZBYAINBOKC-UHFFFAOYSA-N |
| XLogP | 22.18 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1037.49 |
| LogP ≤ 5 | 22.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|