About 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol
2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol (PubChem CID 11830278) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol.
Molecular Properties
| Compound Name | 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol |
| PubChem CID | 11830278 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol |
| SMILES | CC(C)(C)C#CC1=CC(C)(C)CC1O |
| InChI | InChI=1S/C13H20O/c1-12(2,3)7-6-10-8-13(4,5)9-11(10)14/h8,11,14H,9H2,1-5H3 |
| InChIKey | RUROEWDHPMSRIT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol?
The IUPAC name of 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol (CID 11830278) is 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol.
What is the SMILES notation for 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol?
The canonical SMILES for 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol is CC(C)(C)C#CC1=CC(C)(C)CC1O.
What is the InChIKey of 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol?
The InChIKey is RUROEWDHPMSRIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-12(2,3)7-6-10-8-13(4,5)9-11(10)14/h8,11,14H,9H2,1-5H3.
What are the key properties of 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol?
2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol has a molecular weight of 192.30 g/mol, XLogP of 2.75, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylbut-1-ynyl)-4,4-dimethylcyclopent-2-en-1-ol is sourced from PubChem (CID 11830278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).