About [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol
[(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol (PubChem CID 118303271) has the molecular formula C11H20F2N2O
and a molecular weight of 234.29 g/mol. Its IUPAC name is [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol |
| PubChem CID | 118303271 |
| Molecular Formula | C11H20F2N2O |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol |
| SMILES | CN1CCC(N2CC(F)(F)C[C@@H]2CO)CC1 |
| InChI | InChI=1S/C11H20F2N2O/c1-14-4-2-9(3-5-14)15-8-11(12,13)6-10(15)7-16/h9-10,16H,2-8H2,1H3/t10-/m1/s1 |
| InChIKey | IURYMVMITUQFCG-SNVBAGLBSA-N |
| XLogP | 0.78 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol?
The IUPAC name of [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol (CID 118303271) is [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol?
The canonical SMILES for [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol is CN1CCC(N2CC(F)(F)C[C@@H]2CO)CC1.
What is the InChIKey of [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol?
The InChIKey is IURYMVMITUQFCG-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H20F2N2O/c1-14-4-2-9(3-5-14)15-8-11(12,13)6-10(15)7-16/h9-10,16H,2-8H2,1H3/t10-/m1/s1.
What are the key properties of [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol?
[(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol has a molecular weight of 234.29 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4,4-difluoro-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]methanol is sourced from PubChem (CID 118303271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).