About 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile
2-(4-methoxyphenyl)-2,2-diphenylacetonitrile (PubChem CID 118303869) has the molecular formula C21H17NO
and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile |
| PubChem CID | 118303869 |
| Molecular Formula | C21H17NO |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile |
| SMILES | COc1ccc(C(C#N)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17NO/c1-23-20-14-12-19(13-15-20)21(16-22,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15H,1H3 |
| InChIKey | DHPFUKFNHULRNC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile?
The IUPAC name of 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile (CID 118303869) is 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile.
What is the SMILES notation for 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile?
The canonical SMILES for 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile is COc1ccc(C(C#N)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile?
The InChIKey is DHPFUKFNHULRNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO/c1-23-20-14-12-19(13-15-20)21(16-22,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15H,1H3.
What are the key properties of 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile?
2-(4-methoxyphenyl)-2,2-diphenylacetonitrile has a molecular weight of 299.37 g/mol, XLogP of 4.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-2,2-diphenylacetonitrile is sourced from PubChem (CID 118303869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).