About N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide
N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide (PubChem CID 118304329) has the molecular formula C20H28N2O3S
and a molecular weight of 376.52 g/mol. Its IUPAC name is N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide.
Molecular Properties
| Compound Name | N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide |
| PubChem CID | 118304329 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide |
| SMILES | O=C(NC1CCCC1)c1cccc(C2CC2NC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C20H28N2O3S/c23-20(22-16-6-1-2-7-16)15-5-3-4-14(12-15)18-13-19(18)21-17-8-10-26(24,25)11-9-17/h3-5,12,16-19,21H,1-2,6-11,13H2,(H,22,23) |
| InChIKey | AQOLVVOAOMFSNS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide?
The IUPAC name of N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide (CID 118304329) is N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide.
What is the SMILES notation for N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide?
The canonical SMILES for N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide is O=C(NC1CCCC1)c1cccc(C2CC2NC2CCS(=O)(=O)CC2)c1.
What is the InChIKey of N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide?
The InChIKey is AQOLVVOAOMFSNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2O3S/c23-20(22-16-6-1-2-7-16)15-5-3-4-14(12-15)18-13-19(18)21-17-8-10-26(24,25)11-9-17/h3-5,12,16-19,21H,1-2,6-11,13H2,(H,22,23).
What are the key properties of N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide?
N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide has a molecular weight of 376.52 g/mol, XLogP of 2.38, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]benzamide is sourced from PubChem (CID 118304329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).