C20H30N2O3S — CID 118304741
3-[2-(2,2-dimethylpropylamino)cyclopropyl]-N-(1,1-dioxothian-4-yl)benzamide (PubChem CID 118304741) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is 3-[2-(2,2-dimethylpropylamino)cyclopropyl]-N-(1,1-dioxothian-4-yl)benzamide.
| Compound Name | 3-[2-(2,2-dimethylpropylamino)cyclopropyl]-N-(1,1-dioxothian-4-yl)benzamide |
|---|---|
| PubChem CID | 118304741 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 3-[2-(2,2-dimethylpropylamino)cyclopropyl]-N-(1,1-dioxothian-4-yl)benzamide |
| SMILES | CC(C)(C)CNC1CC1c1cccc(C(=O)NC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C20H30N2O3S/c1-20(2,3)13-21-18-12-17(18)14-5-4-6-15(11-14)19(23)22-16-7-9-26(24,25)10-8-16/h4-6,11,16-18,21H,7-10,12-13H2,1-3H3,(H,22,23) |
| InChIKey | IIOFTVDKQSVFIM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |