About bis(2-ethenoxyethyl) carbonate
bis(2-ethenoxyethyl) carbonate (PubChem CID 11830481) has the molecular formula C9H14O5
and a molecular weight of 202.21 g/mol. Its IUPAC name is bis(2-ethenoxyethyl) carbonate.
Molecular Properties
| Compound Name | bis(2-ethenoxyethyl) carbonate |
| PubChem CID | 11830481 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | bis(2-ethenoxyethyl) carbonate |
| SMILES | C=COCCOC(=O)OCCOC=C |
| InChI | InChI=1S/C9H14O5/c1-3-11-5-7-13-9(10)14-8-6-12-4-2/h3-4H,1-2,5-8H2 |
| InChIKey | WRNSYKNOJJOABJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-ethenoxyethyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethenoxyethyl) carbonate?
The IUPAC name of bis(2-ethenoxyethyl) carbonate (CID 11830481) is bis(2-ethenoxyethyl) carbonate.
What is the SMILES notation for bis(2-ethenoxyethyl) carbonate?
The canonical SMILES for bis(2-ethenoxyethyl) carbonate is C=COCCOC(=O)OCCOC=C.
What is the InChIKey of bis(2-ethenoxyethyl) carbonate?
The InChIKey is WRNSYKNOJJOABJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O5/c1-3-11-5-7-13-9(10)14-8-6-12-4-2/h3-4H,1-2,5-8H2.
What are the key properties of bis(2-ethenoxyethyl) carbonate?
bis(2-ethenoxyethyl) carbonate has a molecular weight of 202.21 g/mol, XLogP of 1.46, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethenoxyethyl) carbonate is sourced from PubChem (CID 11830481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).