C20H23F2IN8O4S — CID 118305889
4-[2-(difluoromethyl)-4-methoxybenzimidazol-1-yl]-N-(2-iodo-1-methylsulfonylazetidin-3-yl)-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 118305889) has the molecular formula C20H23F2IN8O4S and a molecular weight of 636.42 g/mol. Its IUPAC name is 4-[2-(difluoromethyl)-4-methoxybenzimidazol-1-yl]-N-(2-iodo-1-methylsulfonylazetidin-3-yl)-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-[2-(difluoromethyl)-4-methoxybenzimidazol-1-yl]-N-(2-iodo-1-methylsulfonylazetidin-3-yl)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118305889 |
| Molecular Formula | C20H23F2IN8O4S |
| Molecular Weight | 636.42 g/mol |
| Exact Mass | 636.06 |
| IUPAC Name | 4-[2-(difluoromethyl)-4-methoxybenzimidazol-1-yl]-N-(2-iodo-1-methylsulfonylazetidin-3-yl)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | COc1cccc2c1nc(C(F)F)n2-c1nc(NC2CN(S(C)(=O)=O)C2I)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H23F2IN8O4S/c1-34-13-5-3-4-12-14(13)25-17(15(21)22)31(12)20-27-18(24-11-10-30(16(11)23)36(2,32)33)26-19(28-20)29-6-8-35-9-7-29/h3-5,11,15-16H,6-10H2,1-2H3,(H,24,26,27,28) |
| InChIKey | HZRLVMILMOUXCW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|