C22H25F5N4O7 — CID 118305921
cyclopropylmethyl [(3S)-1-methyl-2-oxo-3-[[(2S)-2-(2,2,3,3,3-pentafluoropropylcarbamoyloxy)propanoyl]amino]-3,4-dihydro-1,5-benzodiazepin-5-yl] carbonate (PubChem CID 118305921) has the molecular formula C22H25F5N4O7 and a molecular weight of 552.45 g/mol. Its IUPAC name is cyclopropylmethyl [(3S)-1-methyl-2-oxo-3-[[(2S)-2-(2,2,3,3,3-pentafluoropropylcarbamoyloxy)propanoyl]amino]-3,4-dihydro-1,5-benzodiazepin-5-yl] carbonate.
| Compound Name | cyclopropylmethyl [(3S)-1-methyl-2-oxo-3-[[(2S)-2-(2,2,3,3,3-pentafluoropropylcarbamoyloxy)propanoyl]amino]-3,4-dihydro-1,5-benzodiazepin-5-yl] carbonate |
|---|---|
| PubChem CID | 118305921 |
| Molecular Formula | C22H25F5N4O7 |
| Molecular Weight | 552.45 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | cyclopropylmethyl [(3S)-1-methyl-2-oxo-3-[[(2S)-2-(2,2,3,3,3-pentafluoropropylcarbamoyloxy)propanoyl]amino]-3,4-dihydro-1,5-benzodiazepin-5-yl] carbonate |
| SMILES | C[C@H](OC(=O)NCC(F)(F)C(F)(F)F)C(=O)N[C@H]1CN(OC(=O)OCC2CC2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C22H25F5N4O7/c1-12(37-19(34)28-11-21(23,24)22(25,26)27)17(32)29-14-9-31(38-20(35)36-10-13-7-8-13)16-6-4-3-5-15(16)30(2)18(14)33/h3-6,12-14H,7-11H2,1-2H3,(H,28,34)(H,29,32)/t12-,14-/m0/s1 |
| InChIKey | RJIPJBIYBROHDI-JSGCOSHPSA-N |
| XLogP | 2.74 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|