C7H16O10 — CID 118305943
carbonic acid;1-(2-hydroperoxyethoxy)-2-methoxyethane (PubChem CID 118305943) has the molecular formula C7H16O10 and a molecular weight of 260.19 g/mol. Its IUPAC name is carbonic acid;1-(2-hydroperoxyethoxy)-2-methoxyethane.
| Compound Name | carbonic acid;1-(2-hydroperoxyethoxy)-2-methoxyethane |
|---|---|
| PubChem CID | 118305943 |
| Molecular Formula | C7H16O10 |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | carbonic acid;1-(2-hydroperoxyethoxy)-2-methoxyethane |
| SMILES | COCCOCCOO.O=C(O)O.O=C(O)O |
| InChI | InChI=1S/C5H12O4.2CH2O3/c1-7-2-3-8-4-5-9-6;2*2-1(3)4/h6H,2-5H2,1H3;2*(H2,2,3,4) |
| InChIKey | GCDUBOLTYURZKT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|