C19H16FN3O3S — CID 118305944
5-[2-[4-fluoro-2-(2-methoxyethoxy)phenyl]-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 118305944) has the molecular formula C19H16FN3O3S and a molecular weight of 385.42 g/mol. Its IUPAC name is 5-[2-[4-fluoro-2-(2-methoxyethoxy)phenyl]-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[2-[4-fluoro-2-(2-methoxyethoxy)phenyl]-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 118305944 |
| Molecular Formula | C19H16FN3O3S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 5-[2-[4-fluoro-2-(2-methoxyethoxy)phenyl]-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | COCCOc1cc(F)ccc1-c1nc(-c2ccc3[nH]c(=O)[nH]c3c2)cs1 |
| InChI | InChI=1S/C19H16FN3O3S/c1-25-6-7-26-17-9-12(20)3-4-13(17)18-21-16(10-27-18)11-2-5-14-15(8-11)23-19(24)22-14/h2-5,8-10H,6-7H2,1H3,(H2,22,23,24) |
| InChIKey | HZRHRUSGGYDXPN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|