About cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone
cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone (PubChem CID 11830595) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone.
Molecular Properties
| Compound Name | cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone |
| PubChem CID | 11830595 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)C2CCCCC2)cn1C |
| InChI | InChI=1S/C12H18N2O/c1-9-13-11(8-14(9)2)12(15)10-6-4-3-5-7-10/h8,10H,3-7H2,1-2H3 |
| InChIKey | XBFLWVUEVCKPPK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone?
The IUPAC name of cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone (CID 11830595) is cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone.
What is the SMILES notation for cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone?
The canonical SMILES for cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone is Cc1nc(C(=O)C2CCCCC2)cn1C.
What is the InChIKey of cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone?
The InChIKey is XBFLWVUEVCKPPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-9-13-11(8-14(9)2)12(15)10-6-4-3-5-7-10/h8,10H,3-7H2,1-2H3.
What are the key properties of cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone?
cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone has a molecular weight of 206.29 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(1,2-dimethylimidazol-4-yl)methanone is sourced from PubChem (CID 11830595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).