C18H24ClFN6OS — CID 118306350
2-[2-[(4aR,7aS)-2-amino-7a-pyridin-3-yl-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazin-6-yl]-5-fluoropyrimidin-4-yl]propan-2-ol;hydrochloride (PubChem CID 118306350) has the molecular formula C18H24ClFN6OS and a molecular weight of 426.95 g/mol. Its IUPAC name is 2-[2-[(4aR,7aS)-2-amino-7a-pyridin-3-yl-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazin-6-yl]-5-fluoropyrimidin-4-yl]propan-2-ol;hydrochloride.
| Compound Name | 2-[2-[(4aR,7aS)-2-amino-7a-pyridin-3-yl-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazin-6-yl]-5-fluoropyrimidin-4-yl]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 118306350 |
| Molecular Formula | C18H24ClFN6OS |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-[2-[(4aR,7aS)-2-amino-7a-pyridin-3-yl-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazin-6-yl]-5-fluoropyrimidin-4-yl]propan-2-ol;hydrochloride |
| SMILES | CC(C)(O)c1nc(N2C[C@H]3CSC(N)N[C@@]3(c3cccnc3)C2)ncc1F.Cl |
| InChI | InChI=1S/C18H23FN6OS.ClH/c1-17(2,26)14-13(19)7-22-16(23-14)25-8-12-9-27-15(20)24-18(12,10-25)11-4-3-5-21-6-11;/h3-7,12,15,24,26H,8-10,20H2,1-2H3;1H/t12-,15?,18+;/m0./s1 |
| InChIKey | AMZBNNFWIKSQOB-VNUPQQDHSA-N |
| XLogP | 1.57 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |