C14H20N6O2S — CID 118306386
tert-butyl (8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate (PubChem CID 118306386) has the molecular formula C14H20N6O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is tert-butyl (8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate.
| Compound Name | tert-butyl (8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 118306386 |
| Molecular Formula | C14H20N6O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | tert-butyl (8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
| SMILES | Cc1nsc(-c2nnc3n2CCN(C(=O)OC(C)(C)C)[C@@H]3C)n1 |
| InChI | InChI=1S/C14H20N6O2S/c1-8-10-16-17-11(12-15-9(2)18-23-12)20(10)7-6-19(8)13(21)22-14(3,4)5/h8H,6-7H2,1-5H3/t8-/m1/s1 |
| InChIKey | YPGPEKQJPUMUNS-MRVPVSSYSA-N |
| XLogP | 2.42 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |