About 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline
4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline (PubChem CID 11830640) has the molecular formula C10H9FN2S
and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline.
Molecular Properties
| Compound Name | 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline |
| PubChem CID | 11830640 |
| Molecular Formula | C10H9FN2S |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline |
| SMILES | Cc1nc(-c2cc(N)ccc2F)cs1 |
| InChI | InChI=1S/C10H9FN2S/c1-6-13-10(5-14-6)8-4-7(12)2-3-9(8)11/h2-5H,12H2,1H3 |
| InChIKey | XGZHUVUHQYBFIJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline?
The IUPAC name of 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline (CID 11830640) is 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline.
What is the SMILES notation for 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline?
The canonical SMILES for 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline is Cc1nc(-c2cc(N)ccc2F)cs1.
What is the InChIKey of 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline?
The InChIKey is XGZHUVUHQYBFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2S/c1-6-13-10(5-14-6)8-4-7(12)2-3-9(8)11/h2-5H,12H2,1H3.
What are the key properties of 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline?
4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline has a molecular weight of 208.26 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-(2-methyl-1,3-thiazol-4-yl)aniline is sourced from PubChem (CID 11830640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).