About [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol
[(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol (PubChem CID 11830758) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol.
Molecular Properties
| Compound Name | [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol |
| PubChem CID | 11830758 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol |
| SMILES | C[C@H]1c2cccc3cccc(c23)[C@]1(C)CO |
| InChI | InChI=1S/C15H16O/c1-10-12-7-3-5-11-6-4-8-13(14(11)12)15(10,2)9-16/h3-8,10,16H,9H2,1-2H3/t10-,15+/m0/s1 |
| InChIKey | CNLXZIICRQHIGG-ZUZCIYMTSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol?
The IUPAC name of [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol (CID 11830758) is [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol.
What is the SMILES notation for [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol?
The canonical SMILES for [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol is C[C@H]1c2cccc3cccc(c23)[C@]1(C)CO.
What is the InChIKey of [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol?
The InChIKey is CNLXZIICRQHIGG-ZUZCIYMTSA-N. The full InChI is InChI=1S/C15H16O/c1-10-12-7-3-5-11-6-4-8-13(14(11)12)15(10,2)9-16/h3-8,10,16H,9H2,1-2H3/t10-,15+/m0/s1.
What are the key properties of [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol?
[(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol has a molecular weight of 212.29 g/mol, XLogP of 3.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol is sourced from PubChem (CID 11830758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).