C23H22F3N3O5 — CID 118307593
2-[2-(2-hydroxyethoxy)ethoxy]-5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid (PubChem CID 118307593) has the molecular formula C23H22F3N3O5 and a molecular weight of 477.44 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]-5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]-5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 118307593 |
| Molecular Formula | C23H22F3N3O5 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]-5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2ccc(OCCOCCO)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C23H22F3N3O5/c1-14-10-16(12-17(11-14)28-22-27-5-4-20(29-22)23(24,25)26)15-2-3-19(18(13-15)21(31)32)34-9-8-33-7-6-30/h2-5,10-13,30H,6-9H2,1H3,(H,31,32)(H,27,28,29) |
| InChIKey | CMQFVENNWYUOCE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|