C20H12F9N3O — CID 118307643
1,1,1,3,3,3-hexafluoro-2-[4-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]phenyl]propan-2-ol (PubChem CID 118307643) has the molecular formula C20H12F9N3O and a molecular weight of 481.32 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 118307643 |
| Molecular Formula | C20H12F9N3O |
| Molecular Weight | 481.32 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]phenyl]propan-2-ol |
| SMILES | OC(c1ccc(-c2cccc(Nc3nccc(C(F)(F)F)n3)c2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H12F9N3O/c21-18(22,23)15-8-9-30-16(32-15)31-14-3-1-2-12(10-14)11-4-6-13(7-5-11)17(33,19(24,25)26)20(27,28)29/h1-10,33H,(H,30,31,32) |
| InChIKey | QWXUCYGBPGKCDO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.32 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |