About propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate
propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate (PubChem CID 118307827) has the molecular formula C18H25BrN2O3
and a molecular weight of 397.31 g/mol. Its IUPAC name is propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate |
| PubChem CID | 118307827 |
| Molecular Formula | C18H25BrN2O3 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate |
| SMILES | Cc1nc(C)c(C(=O)C(=O)OC(C)C)c(N2CCC(C)CC2)c1Br |
| InChI | InChI=1S/C18H25BrN2O3/c1-10(2)24-18(23)17(22)14-12(4)20-13(5)15(19)16(14)21-8-6-11(3)7-9-21/h10-11H,6-9H2,1-5H3 |
| InChIKey | ICVPYFXOORFIGW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate?
The IUPAC name of propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate (CID 118307827) is propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate.
What is the SMILES notation for propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate?
The canonical SMILES for propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate is Cc1nc(C)c(C(=O)C(=O)OC(C)C)c(N2CCC(C)CC2)c1Br.
What is the InChIKey of propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate?
The InChIKey is ICVPYFXOORFIGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25BrN2O3/c1-10(2)24-18(23)17(22)14-12(4)20-13(5)15(19)16(14)21-8-6-11(3)7-9-21/h10-11H,6-9H2,1-5H3.
What are the key properties of propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate?
propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate has a molecular weight of 397.31 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[5-bromo-2,6-dimethyl-4-(4-methylpiperidin-1-yl)-3-pyridinyl]-2-oxoacetate is sourced from PubChem (CID 118307827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).