About CID 118307979
CID 118307979 (PubChem CID 118307979) has the molecular formula C16H15F2N3Na2O3S
and a molecular weight of 413.36 g/mol.
Molecular Properties
| Compound Name | CID 118307979 |
| PubChem CID | 118307979 |
| Molecular Formula | C16H15F2N3Na2O3S |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | — |
| SMILES | Cc1c[nH]c(CS(=O)c2nc3ccc(OC(F)F)cc3[nH]2)c(C)c1=O.[Na].[Na] |
| InChI | InChI=1S/C16H15F2N3O3S.2Na/c1-8-6-19-13(9(2)14(8)22)7-25(23)16-20-11-4-3-10(24-15(17)18)5-12(11)21-16;;/h3-6,15H,7H2,1-2H3,(H,19,22)(H,20,21);; |
| InChIKey | DYNGXZHQLPYLPS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 118307979 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118307979?
The IUPAC name of CID 118307979 (CID 118307979) is not available.
What is the SMILES notation for CID 118307979?
The canonical SMILES for CID 118307979 is Cc1c[nH]c(CS(=O)c2nc3ccc(OC(F)F)cc3[nH]2)c(C)c1=O.[Na].[Na].
What is the InChIKey of CID 118307979?
The InChIKey is DYNGXZHQLPYLPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2N3O3S.2Na/c1-8-6-19-13(9(2)14(8)22)7-25(23)16-20-11-4-3-10(24-15(17)18)5-12(11)21-16;;/h3-6,15H,7H2,1-2H3,(H,19,22)(H,20,21);;.
What are the key properties of CID 118307979?
CID 118307979 has a molecular weight of 413.36 g/mol, XLogP of 2.02, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118307979 is sourced from PubChem (CID 118307979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).