C16H15F2N3Na2O3S — CID 118307979
CID 118307979 (PubChem CID 118307979) has the molecular formula C16H15F2N3Na2O3S and a molecular weight of 413.36 g/mol.
| Compound Name | CID 118307979 |
|---|---|
| PubChem CID | 118307979 |
| Molecular Formula | C16H15F2N3Na2O3S |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | — |
| SMILES | Cc1c[nH]c(CS(=O)c2nc3ccc(OC(F)F)cc3[nH]2)c(C)c1=O.[Na].[Na] |
| InChI | InChI=1S/C16H15F2N3O3S.2Na/c1-8-6-19-13(9(2)14(8)22)7-25(23)16-20-11-4-3-10(24-15(17)18)5-12(11)21-16;;/h3-6,15H,7H2,1-2H3,(H,19,22)(H,20,21);; |
| InChIKey | DYNGXZHQLPYLPS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |