About N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide
N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide (PubChem CID 118308166) has the molecular formula C9H18F2N2O2S
and a molecular weight of 256.32 g/mol. Its IUPAC name is N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide.
Molecular Properties
| Compound Name | N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide |
| PubChem CID | 118308166 |
| Molecular Formula | C9H18F2N2O2S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NC1CC(F)(F)CC1N |
| InChI | InChI=1S/C9H18F2N2O2S/c1-8(2,3)16(14,15)13-7-5-9(10,11)4-6(7)12/h6-7,13H,4-5,12H2,1-3H3 |
| InChIKey | KAERCXSUTOLGFD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide?
The IUPAC name of N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide (CID 118308166) is N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide.
What is the SMILES notation for N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide?
The canonical SMILES for N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide is CC(C)(C)S(=O)(=O)NC1CC(F)(F)CC1N.
What is the InChIKey of N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide?
The InChIKey is KAERCXSUTOLGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F2N2O2S/c1-8(2,3)16(14,15)13-7-5-9(10,11)4-6(7)12/h6-7,13H,4-5,12H2,1-3H3.
What are the key properties of N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide?
N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide has a molecular weight of 256.32 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-4,4-difluorocyclopentyl)-2-methylpropane-2-sulfonamide is sourced from PubChem (CID 118308166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).