About 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione
1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione (PubChem CID 118308418) has the molecular formula C17H28N4O4S
and a molecular weight of 384.50 g/mol. Its IUPAC name is 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione |
| PubChem CID | 118308418 |
| Molecular Formula | C17H28N4O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione |
| SMILES | CC1CCN(C2CCN(S(=O)(=O)c3cn(C)c(=O)n(C)c3=O)CC2)CC1 |
| InChI | InChI=1S/C17H28N4O4S/c1-13-4-8-20(9-5-13)14-6-10-21(11-7-14)26(24,25)15-12-18(2)17(23)19(3)16(15)22/h12-14H,4-11H2,1-3H3 |
| InChIKey | BDFAOZUCQAENCO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione?
The IUPAC name of 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione (CID 118308418) is 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione.
What is the SMILES notation for 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione?
The canonical SMILES for 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione is CC1CCN(C2CCN(S(=O)(=O)c3cn(C)c(=O)n(C)c3=O)CC2)CC1.
What is the InChIKey of 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione?
The InChIKey is BDFAOZUCQAENCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4O4S/c1-13-4-8-20(9-5-13)14-6-10-21(11-7-14)26(24,25)15-12-18(2)17(23)19(3)16(15)22/h12-14H,4-11H2,1-3H3.
What are the key properties of 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione?
1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione has a molecular weight of 384.50 g/mol, XLogP of -0.03, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]sulfonylpyrimidine-2,4-dione is sourced from PubChem (CID 118308418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).