C22H24FN5O2S — CID 118308643
N-cyclopropyl-3-[4-(2-fluoro-5-methylphenyl)sulfonylpiperazin-1-yl]quinoxalin-2-amine (PubChem CID 118308643) has the molecular formula C22H24FN5O2S and a molecular weight of 441.53 g/mol. Its IUPAC name is N-cyclopropyl-3-[4-(2-fluoro-5-methylphenyl)sulfonylpiperazin-1-yl]quinoxalin-2-amine.
| Compound Name | N-cyclopropyl-3-[4-(2-fluoro-5-methylphenyl)sulfonylpiperazin-1-yl]quinoxalin-2-amine |
|---|---|
| PubChem CID | 118308643 |
| Molecular Formula | C22H24FN5O2S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N-cyclopropyl-3-[4-(2-fluoro-5-methylphenyl)sulfonylpiperazin-1-yl]quinoxalin-2-amine |
| SMILES | Cc1ccc(F)c(S(=O)(=O)N2CCN(c3nc4ccccc4nc3NC3CC3)CC2)c1 |
| InChI | InChI=1S/C22H24FN5O2S/c1-15-6-9-17(23)20(14-15)31(29,30)28-12-10-27(11-13-28)22-21(24-16-7-8-16)25-18-4-2-3-5-19(18)26-22/h2-6,9,14,16H,7-8,10-13H2,1H3,(H,24,25) |
| InChIKey | STYLRNQVHNJZPH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |